C10H18F3N3O8S3 — CID 138622814
N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide (PubChem CID 138622814) has the molecular formula C10H18F3N3O8S3 and a molecular weight of 461.46 g/mol. Its IUPAC name is N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide.
| Compound Name | N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
|---|---|
| PubChem CID | 138622814 |
| Molecular Formula | C10H18F3N3O8S3 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | N-[2-[(2-oxooxolan-3-yl)amino]ethyl]-N'-(trifluoromethylsulfonyl)propane-1,3-disulfonamide |
| SMILES | O=C1OCCC1NCCNS(=O)(=O)CCCS(=O)(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O8S3/c11-10(12,13)27(22,23)16-26(20,21)7-1-6-25(18,19)15-4-3-14-8-2-5-24-9(8)17/h8,14-16H,1-7H2 |
| InChIKey | KOOHRDGZRZNVJN-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 164.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|