C10H18F3N3O9S3 — CID 163824344
3-[2-[3-[oxido(trifluoromethylsulfonyl)azaniumyl]sulfonylpropylsulfonylamino]ethylamino]-2-oxooxolane (PubChem CID 163824344) has the molecular formula C10H18F3N3O9S3 and a molecular weight of 477.46 g/mol. Its IUPAC name is 3-[2-[3-[oxido(trifluoromethylsulfonyl)azaniumyl]sulfonylpropylsulfonylamino]ethylamino]-2-oxooxolane.
| Compound Name | 3-[2-[3-[oxido(trifluoromethylsulfonyl)azaniumyl]sulfonylpropylsulfonylamino]ethylamino]-2-oxooxolane |
|---|---|
| PubChem CID | 163824344 |
| Molecular Formula | C10H18F3N3O9S3 |
| Molecular Weight | 477.46 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 3-[2-[3-[oxido(trifluoromethylsulfonyl)azaniumyl]sulfonylpropylsulfonylamino]ethylamino]-2-oxooxolane |
| SMILES | O=C1OCCC1NCCNS(=O)(=O)CCCS(=O)(=O)[NH+]([O-])S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H18F3N3O9S3/c11-10(12,13)28(23,24)16(18)27(21,22)7-1-6-26(19,20)15-4-3-14-8-2-5-25-9(8)17/h8,14-16H,1-7H2 |
| InChIKey | NYDFMRUOLFCBON-UHFFFAOYSA-N |
| XLogP | -3.24 |
| TPSA | 180.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.46 |
| LogP ≤ 5 | -3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|