C12H19NO2S — CID 68807261
2-[(2R)-2-phenylpropyl]sulfonylpropan-2-amine (PubChem CID 68807261) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-[(2R)-2-phenylpropyl]sulfonylpropan-2-amine.
| Compound Name | 2-[(2R)-2-phenylpropyl]sulfonylpropan-2-amine |
|---|---|
| PubChem CID | 68807261 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-[(2R)-2-phenylpropyl]sulfonylpropan-2-amine |
| SMILES | C[C@@H](CS(=O)(=O)C(C)(C)N)c1ccccc1 |
| InChI | InChI=1S/C12H19NO2S/c1-10(11-7-5-4-6-8-11)9-16(14,15)12(2,3)13/h4-8,10H,9,13H2,1-3H3/t10-/m0/s1 |
| InChIKey | SKKRPMJOPHBJGD-JTQLQIEISA-N |
| XLogP | 1.90 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |