C22H22O5S — CID 57306662
3-(1,3-diphenylbutyl)-2,6-dihydroxybenzenesulfonic acid (PubChem CID 57306662) has the molecular formula C22H22O5S and a molecular weight of 398.48 g/mol. Its IUPAC name is 3-(1,3-diphenylbutyl)-2,6-dihydroxybenzenesulfonic acid.
| Compound Name | 3-(1,3-diphenylbutyl)-2,6-dihydroxybenzenesulfonic acid |
|---|---|
| PubChem CID | 57306662 |
| Molecular Formula | C22H22O5S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 3-(1,3-diphenylbutyl)-2,6-dihydroxybenzenesulfonic acid |
| SMILES | CC(CC(c1ccccc1)c1ccc(O)c(S(=O)(=O)O)c1O)c1ccccc1 |
| InChI | InChI=1S/C22H22O5S/c1-15(16-8-4-2-5-9-16)14-19(17-10-6-3-7-11-17)18-12-13-20(23)22(21(18)24)28(25,26)27/h2-13,15,19,23-24H,14H2,1H3,(H,25,26,27) |
| InChIKey | XQTMXSXIQMQZOZ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|