C20H18O7S2 — CID 19033746
4-hydroxy-2-phenyl-5-(1-phenylethyl)benzene-1,3-disulfonic acid (PubChem CID 19033746) has the molecular formula C20H18O7S2 and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-hydroxy-2-phenyl-5-(1-phenylethyl)benzene-1,3-disulfonic acid.
| Compound Name | 4-hydroxy-2-phenyl-5-(1-phenylethyl)benzene-1,3-disulfonic acid |
|---|---|
| PubChem CID | 19033746 |
| Molecular Formula | C20H18O7S2 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-hydroxy-2-phenyl-5-(1-phenylethyl)benzene-1,3-disulfonic acid |
| SMILES | CC(c1ccccc1)c1cc(S(=O)(=O)O)c(-c2ccccc2)c(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C20H18O7S2/c1-13(14-8-4-2-5-9-14)16-12-17(28(22,23)24)18(15-10-6-3-7-11-15)20(19(16)21)29(25,26)27/h2-13,21H,1H3,(H,22,23,24)(H,25,26,27) |
| InChIKey | UVWMDMWXCATDLS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|