C23H24O4S — CID 19033723
5-(1,3-diphenylbutyl)-2-hydroxy-4-methylbenzenesulfonic acid (PubChem CID 19033723) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is 5-(1,3-diphenylbutyl)-2-hydroxy-4-methylbenzenesulfonic acid.
| Compound Name | 5-(1,3-diphenylbutyl)-2-hydroxy-4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 19033723 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 5-(1,3-diphenylbutyl)-2-hydroxy-4-methylbenzenesulfonic acid |
| SMILES | Cc1cc(O)c(S(=O)(=O)O)cc1C(CC(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24O4S/c1-16(18-9-5-3-6-10-18)13-21(19-11-7-4-8-12-19)20-15-23(28(25,26)27)22(24)14-17(20)2/h3-12,14-16,21,24H,13H2,1-2H3,(H,25,26,27) |
| InChIKey | HLEVRNCKYZFOLB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|