C18H22O3S — CID 18731128
4-(5-phenylhexan-3-yl)benzenesulfonic acid (PubChem CID 18731128) has the molecular formula C18H22O3S and a molecular weight of 318.44 g/mol. Its IUPAC name is 4-(5-phenylhexan-3-yl)benzenesulfonic acid.
| Compound Name | 4-(5-phenylhexan-3-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 18731128 |
| Molecular Formula | C18H22O3S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 4-(5-phenylhexan-3-yl)benzenesulfonic acid |
| SMILES | CCC(CC(C)c1ccccc1)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C18H22O3S/c1-3-15(13-14(2)16-7-5-4-6-8-16)17-9-11-18(12-10-17)22(19,20)21/h4-12,14-15H,3,13H2,1-2H3,(H,19,20,21) |
| InChIKey | BMBCGUMUUCTREM-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|