C19H22O2 — CID 20813389
4-(5-phenylhexan-3-yl)benzoic acid (PubChem CID 20813389) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-(5-phenylhexan-3-yl)benzoic acid.
| Compound Name | 4-(5-phenylhexan-3-yl)benzoic acid |
|---|---|
| PubChem CID | 20813389 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 4-(5-phenylhexan-3-yl)benzoic acid |
| SMILES | CCC(CC(C)c1ccccc1)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C19H22O2/c1-3-15(13-14(2)16-7-5-4-6-8-16)17-9-11-18(12-10-17)19(20)21/h4-12,14-15H,3,13H2,1-2H3,(H,20,21) |
| InChIKey | FFFHJKGLJBOECC-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |