C33H42O2 — CID 134941596
4-(3,11-diphenyltetradecan-7-yl)benzoic acid (PubChem CID 134941596) has the molecular formula C33H42O2 and a molecular weight of 470.70 g/mol. Its IUPAC name is 4-(3,11-diphenyltetradecan-7-yl)benzoic acid.
| Compound Name | 4-(3,11-diphenyltetradecan-7-yl)benzoic acid |
|---|---|
| PubChem CID | 134941596 |
| Molecular Formula | C33H42O2 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | 4-(3,11-diphenyltetradecan-7-yl)benzoic acid |
| SMILES | CCCC(CCCC(CCCC(CC)c1ccccc1)c1ccc(C(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C33H42O2/c1-3-13-27(29-16-9-6-10-17-29)19-12-21-30(31-22-24-32(25-23-31)33(34)35)20-11-18-26(4-2)28-14-7-5-8-15-28/h5-10,14-17,22-27,30H,3-4,11-13,18-21H2,1-2H3,(H,34,35) |
| InChIKey | VXIWQSBKBPIQAP-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |