C13H18O2 — CID 134848322
(2R,4R)-2-methyl-4-phenylhexanoic acid (PubChem CID 134848322) has the molecular formula C13H18O2 and a molecular weight of 206.28 g/mol. Its IUPAC name is (2R,4R)-2-methyl-4-phenylhexanoic acid.
| Compound Name | (2R,4R)-2-methyl-4-phenylhexanoic acid |
|---|---|
| PubChem CID | 134848322 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | (2R,4R)-2-methyl-4-phenylhexanoic acid |
| SMILES | CC[C@H](C[C@@H](C)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-3-11(9-10(2)13(14)15)12-7-5-4-6-8-12/h4-8,10-11H,3,9H2,1-2H3,(H,14,15)/t10-,11-/m1/s1 |
| InChIKey | ADLMQKUCLCUQKZ-GHMZBOCLSA-N |
| XLogP | 3.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |