About ethane;methane;5-methylheptan-3-ylbenzene
ethane;methane;5-methylheptan-3-ylbenzene (PubChem CID 168921698) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is ethane;methane;5-methylheptan-3-ylbenzene.
Molecular Properties
| Compound Name | ethane;methane;5-methylheptan-3-ylbenzene |
| PubChem CID | 168921698 |
| Molecular Formula | C18H36 |
| Molecular Weight | 252.49 g/mol |
| Exact Mass | 252.28 |
| IUPAC Name | ethane;methane;5-methylheptan-3-ylbenzene |
| SMILES | C.C.CC.CCC(C)CC(CC)c1ccccc1 |
| InChI | InChI=1S/C14H22.C2H6.2CH4/c1-4-12(3)11-13(5-2)14-9-7-6-8-10-14;1-2;;/h6-10,12-13H,4-5,11H2,1-3H3;1-2H3;2*1H4 |
| InChIKey | IZHQMXDKHSROPK-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.49 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;methane;5-methylheptan-3-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;5-methylheptan-3-ylbenzene?
The IUPAC name of ethane;methane;5-methylheptan-3-ylbenzene (CID 168921698) is ethane;methane;5-methylheptan-3-ylbenzene.
What is the SMILES notation for ethane;methane;5-methylheptan-3-ylbenzene?
The canonical SMILES for ethane;methane;5-methylheptan-3-ylbenzene is C.C.CC.CCC(C)CC(CC)c1ccccc1.
What is the InChIKey of ethane;methane;5-methylheptan-3-ylbenzene?
The InChIKey is IZHQMXDKHSROPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C2H6.2CH4/c1-4-12(3)11-13(5-2)14-9-7-6-8-10-14;1-2;;/h6-10,12-13H,4-5,11H2,1-3H3;1-2H3;2*1H4.
What are the key properties of ethane;methane;5-methylheptan-3-ylbenzene?
ethane;methane;5-methylheptan-3-ylbenzene has a molecular weight of 252.49 g/mol, XLogP of 6.91, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;5-methylheptan-3-ylbenzene is sourced from PubChem (CID 168921698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).