C20H20Br2O2 — CID 140733677
2-(1,3-diphenylpentyl)propanedioyl dibromide (PubChem CID 140733677) has the molecular formula C20H20Br2O2 and a molecular weight of 452.19 g/mol. Its IUPAC name is 2-(1,3-diphenylpentyl)propanedioyl dibromide.
| Compound Name | 2-(1,3-diphenylpentyl)propanedioyl dibromide |
|---|---|
| PubChem CID | 140733677 |
| Molecular Formula | C20H20Br2O2 |
| Molecular Weight | 452.19 g/mol |
| Exact Mass | 449.98 |
| IUPAC Name | 2-(1,3-diphenylpentyl)propanedioyl dibromide |
| SMILES | CCC(CC(c1ccccc1)C(C(=O)Br)C(=O)Br)c1ccccc1 |
| InChI | InChI=1S/C20H20Br2O2/c1-2-14(15-9-5-3-6-10-15)13-17(16-11-7-4-8-12-16)18(19(21)23)20(22)24/h3-12,14,17-18H,2,13H2,1H3 |
| InChIKey | BSTLAFNGLLHCLB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.19 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|