About 1-ethylsulfonylethane;2-phenylbutanenitrile
1-ethylsulfonylethane;2-phenylbutanenitrile (PubChem CID 174853089) has the molecular formula C14H21NO2S
and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-ethylsulfonylethane;2-phenylbutanenitrile.
Molecular Properties
| Compound Name | 1-ethylsulfonylethane;2-phenylbutanenitrile |
| PubChem CID | 174853089 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 1-ethylsulfonylethane;2-phenylbutanenitrile |
| SMILES | CCC(C#N)c1ccccc1.CCS(=O)(=O)CC |
| InChI | InChI=1S/C10H11N.C4H10O2S/c1-2-9(8-11)10-6-4-3-5-7-10;1-3-7(5,6)4-2/h3-7,9H,2H2,1H3;3-4H2,1-2H3 |
| InChIKey | MKNOVORYIZHDIY-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylsulfonylethane;2-phenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylsulfonylethane;2-phenylbutanenitrile?
The IUPAC name of 1-ethylsulfonylethane;2-phenylbutanenitrile (CID 174853089) is 1-ethylsulfonylethane;2-phenylbutanenitrile.
What is the SMILES notation for 1-ethylsulfonylethane;2-phenylbutanenitrile?
The canonical SMILES for 1-ethylsulfonylethane;2-phenylbutanenitrile is CCC(C#N)c1ccccc1.CCS(=O)(=O)CC.
What is the InChIKey of 1-ethylsulfonylethane;2-phenylbutanenitrile?
The InChIKey is MKNOVORYIZHDIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C4H10O2S/c1-2-9(8-11)10-6-4-3-5-7-10;1-3-7(5,6)4-2/h3-7,9H,2H2,1H3;3-4H2,1-2H3.
What are the key properties of 1-ethylsulfonylethane;2-phenylbutanenitrile?
1-ethylsulfonylethane;2-phenylbutanenitrile has a molecular weight of 267.39 g/mol, XLogP of 3.14, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylsulfonylethane;2-phenylbutanenitrile is sourced from PubChem (CID 174853089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).