C11H12NO3S- — CID 131716210
4-cyano-4-phenylbutane-1-sulfonate (PubChem CID 131716210) has the molecular formula C11H12NO3S- and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-cyano-4-phenylbutane-1-sulfonate.
| Compound Name | 4-cyano-4-phenylbutane-1-sulfonate |
|---|---|
| PubChem CID | 131716210 |
| Molecular Formula | C11H12NO3S- |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-cyano-4-phenylbutane-1-sulfonate |
| SMILES | N#CC(CCCS(=O)(=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C11H13NO3S/c12-9-11(7-4-8-16(13,14)15)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-8H2,(H,13,14,15)/p-1 |
| InChIKey | RPRLRYMDECJTQG-UHFFFAOYSA-M |
| XLogP | 1.62 |
| TPSA | 80.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|