C19H21NO — CID 82136917
5-(3,5-dimethylphenoxy)-2-phenylpentanenitrile (PubChem CID 82136917) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5-(3,5-dimethylphenoxy)-2-phenylpentanenitrile.
| Compound Name | 5-(3,5-dimethylphenoxy)-2-phenylpentanenitrile |
|---|---|
| PubChem CID | 82136917 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5-(3,5-dimethylphenoxy)-2-phenylpentanenitrile |
| SMILES | Cc1cc(C)cc(OCCCC(C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO/c1-15-11-16(2)13-19(12-15)21-10-6-9-18(14-20)17-7-4-3-5-8-17/h3-5,7-8,11-13,18H,6,9-10H2,1-2H3 |
| InChIKey | DEIWMFRXDLOPEA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|