C19H21NO — CID 82136903
6-(3-methylphenoxy)-2-phenylhexanenitrile (PubChem CID 82136903) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 6-(3-methylphenoxy)-2-phenylhexanenitrile.
| Compound Name | 6-(3-methylphenoxy)-2-phenylhexanenitrile |
|---|---|
| PubChem CID | 82136903 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 6-(3-methylphenoxy)-2-phenylhexanenitrile |
| SMILES | Cc1cccc(OCCCCC(C#N)c2ccccc2)c1 |
| InChI | InChI=1S/C19H21NO/c1-16-8-7-12-19(14-16)21-13-6-5-11-18(15-20)17-9-3-2-4-10-17/h2-4,7-10,12,14,18H,5-6,11,13H2,1H3 |
| InChIKey | SHRBYWXDWFUGFV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|