C17H20NNaO3S — CID 23676813
sodium 3-(2,2-diphenylethylamino)propane-1-sulfonate (PubChem CID 23676813) has the molecular formula C17H20NNaO3S and a molecular weight of 341.41 g/mol. Its IUPAC name is sodium 3-(2,2-diphenylethylamino)propane-1-sulfonate.
| Compound Name | sodium 3-(2,2-diphenylethylamino)propane-1-sulfonate |
|---|---|
| PubChem CID | 23676813 |
| Molecular Formula | C17H20NNaO3S |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | sodium 3-(2,2-diphenylethylamino)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCNCC(c1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C17H21NO3S.Na/c19-22(20,21)13-7-12-18-14-17(15-8-3-1-4-9-15)16-10-5-2-6-11-16;/h1-6,8-11,17-18H,7,12-14H2,(H,19,20,21);/q;+1/p-1 |
| InChIKey | QKJFPTHWCQWEJI-UHFFFAOYSA-M |
| XLogP | -0.65 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|