C21H26O3Si — CID 10021049
3-[methyl(diphenyl)silyl]propanoyl 2,2-dimethylpropanoate (PubChem CID 10021049) has the molecular formula C21H26O3Si and a molecular weight of 354.52 g/mol. Its IUPAC name is 3-[methyl(diphenyl)silyl]propanoyl 2,2-dimethylpropanoate.
| Compound Name | 3-[methyl(diphenyl)silyl]propanoyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 10021049 |
| Molecular Formula | C21H26O3Si |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | 3-[methyl(diphenyl)silyl]propanoyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)CC[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26O3Si/c1-21(2,3)20(23)24-19(22)15-16-25(4,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,15-16H2,1-4H3 |
| InChIKey | GSMZXFMJMDBCGX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|