C14H24O — CID 143415964
2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (PubChem CID 143415964) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one.
| Compound Name | 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
|---|---|
| PubChem CID | 143415964 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 2,3-diethyl-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| SMILES | CCC1CC2CCCCC2C(=O)C1CC |
| InChI | InChI=1S/C14H24O/c1-3-10-9-11-7-5-6-8-13(11)14(15)12(10)4-2/h10-13H,3-9H2,1-2H3 |
| InChIKey | DVQQSRBVFQBASR-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |