C12H18O — CID 132503865
(1S,3S,5R,8R)-tricyclo[6.4.0.03,5]dodecan-2-one (PubChem CID 132503865) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (1S,3S,5R,8R)-tricyclo[6.4.0.03,5]dodecan-2-one.
| Compound Name | (1S,3S,5R,8R)-tricyclo[6.4.0.03,5]dodecan-2-one |
|---|---|
| PubChem CID | 132503865 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (1S,3S,5R,8R)-tricyclo[6.4.0.03,5]dodecan-2-one |
| SMILES | O=C1[C@H]2CCCC[C@@H]2CC[C@@H]2C[C@H]12 |
| InChI | InChI=1S/C12H18O/c13-12-10-4-2-1-3-8(10)5-6-9-7-11(9)12/h8-11H,1-7H2/t8-,9-,10+,11+/m1/s1 |
| InChIKey | CTBWZLNLCXPNGP-ZNSHCXBVSA-N |
| XLogP | 2.79 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |