C11H16O3 — CID 89372645
4,5-dipropylcyclopentane-1,2,3-trione (PubChem CID 89372645) has the molecular formula C11H16O3 and a molecular weight of 196.25 g/mol. Its IUPAC name is 4,5-dipropylcyclopentane-1,2,3-trione.
| Compound Name | 4,5-dipropylcyclopentane-1,2,3-trione |
|---|---|
| PubChem CID | 89372645 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 4,5-dipropylcyclopentane-1,2,3-trione |
| SMILES | CCCC1C(=O)C(=O)C(=O)C1CCC |
| InChI | InChI=1S/C11H16O3/c1-3-5-7-8(6-4-2)10(13)11(14)9(7)12/h7-8H,3-6H2,1-2H3 |
| InChIKey | ITXLHANCDDGIJC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|