C13H20O4 — CID 90985729
4-hydroxy-5-octylcyclopentane-1,2,3-trione (PubChem CID 90985729) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-hydroxy-5-octylcyclopentane-1,2,3-trione.
| Compound Name | 4-hydroxy-5-octylcyclopentane-1,2,3-trione |
|---|---|
| PubChem CID | 90985729 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 4-hydroxy-5-octylcyclopentane-1,2,3-trione |
| SMILES | CCCCCCCCC1C(=O)C(=O)C(=O)C1O |
| InChI | InChI=1S/C13H20O4/c1-2-3-4-5-6-7-8-9-10(14)12(16)13(17)11(9)15/h9-10,14H,2-8H2,1H3 |
| InChIKey | QXNGJTKQHUZQLC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|