C20H32O3 — CID 102187919
4,5,6,7-tetrapropyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 102187919) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 4,5,6,7-tetrapropyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4,5,6,7-tetrapropyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 102187919 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 4,5,6,7-tetrapropyl-3a,4,7,7a-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | CCCC1=C(CCC)C(CCC)C2C(=O)OC(=O)C2C1CCC |
| InChI | InChI=1S/C20H32O3/c1-5-9-13-14(10-6-2)16(12-8-4)18-17(15(13)11-7-3)19(21)23-20(18)22/h15-18H,5-12H2,1-4H3 |
| InChIKey | GPYCVDNWAUHCOO-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|