C12H10O3 — CID 124921392
(1R,2S,4S,8S,10R,11R)-6-oxahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione (PubChem CID 124921392) has the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is (1R,2S,4S,8S,10R,11R)-6-oxahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione.
| Compound Name | (1R,2S,4S,8S,10R,11R)-6-oxahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
|---|---|
| PubChem CID | 124921392 |
| Molecular Formula | C12H10O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (1R,2S,4S,8S,10R,11R)-6-oxahexacyclo[7.4.0.02,13.03,11.04,8.010,12]tridecane-5,7-dione |
| SMILES | O=C1OC(=O)[C@H]2C3[C@@H]4C5C6C(C(C54)[C@H]12)[C@@H]63 |
| InChI | InChI=1S/C12H10O3/c13-11-9-7-3-1-2-5(7)6(2)8(4(1)3)10(9)12(14)15-11/h1-10H/t1?,2?,3-,4?,5-,6?,7?,8?,9+,10+/m1/s1 |
| InChIKey | JFCSHHUQDPLGHG-HGRGRESKSA-N |
| XLogP | 0.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|