C5H6N2O4 — CID 141227238
5-(hydroxymethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 141227238) has the molecular formula C5H6N2O4 and a molecular weight of 158.11 g/mol. Its IUPAC name is 5-(hydroxymethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(hydroxymethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 141227238 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 5-(hydroxymethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(CO)C(=O)N1 |
| InChI | InChI=1S/C5H6N2O4/c8-1-2-3(9)6-5(11)7-4(2)10/h2,8H,1H2,(H2,6,7,9,10,11) |
| InChIKey | MMDHADJQWKZCAO-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|