C6H9N3O3 — CID 82647071
5-(2-aminoethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 82647071) has the molecular formula C6H9N3O3 and a molecular weight of 171.16 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(2-aminoethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 82647071 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 5-(2-aminoethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | NCCC1C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C6H9N3O3/c7-2-1-3-4(10)8-6(12)9-5(3)11/h3H,1-2,7H2,(H2,8,9,10,11,12) |
| InChIKey | RBWKSMDYYMPVPG-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|