C10H10Cl2N2O — CID 131282881
3-(2-aminoethyl)-4,6-dichloro-1,3-dihydroindol-2-one (PubChem CID 131282881) has the molecular formula C10H10Cl2N2O and a molecular weight of 245.11 g/mol. Its IUPAC name is 3-(2-aminoethyl)-4,6-dichloro-1,3-dihydroindol-2-one.
| Compound Name | 3-(2-aminoethyl)-4,6-dichloro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 131282881 |
| Molecular Formula | C10H10Cl2N2O |
| Molecular Weight | 245.11 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | 3-(2-aminoethyl)-4,6-dichloro-1,3-dihydroindol-2-one |
| SMILES | NCCC1C(=O)Nc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C10H10Cl2N2O/c11-5-3-7(12)9-6(1-2-13)10(15)14-8(9)4-5/h3-4,6H,1-2,13H2,(H,14,15) |
| InChIKey | AXFNCTDYZKZOLJ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.11 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |