C14H18ClN3O — CID 22181640
6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one (PubChem CID 22181640) has the molecular formula C14H18ClN3O and a molecular weight of 279.77 g/mol. Its IUPAC name is 6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one.
| Compound Name | 6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 22181640 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 6-chloro-5-(2-piperazin-1-ylethyl)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(CCN3CCNCC3)c(Cl)cc2N1 |
| InChI | InChI=1S/C14H18ClN3O/c15-12-9-13-11(8-14(19)17-13)7-10(12)1-4-18-5-2-16-3-6-18/h7,9,16H,1-6,8H2,(H,17,19) |
| InChIKey | LLNIWWGUWKFGLE-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |