C9H8N4O6 — CID 5141165
5-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 5141165) has the molecular formula C9H8N4O6 and a molecular weight of 268.19 g/mol. Its IUPAC name is 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 5141165 |
| Molecular Formula | C9H8N4O6 |
| Molecular Weight | 268.19 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 5-[(2,4,6-trioxo-1,3-diazinan-5-yl)methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(CC2C(=O)NC(=O)NC2=O)C(=O)N1 |
| InChI | InChI=1S/C9H8N4O6/c14-4-2(5(15)11-8(18)10-4)1-3-6(16)12-9(19)13-7(3)17/h2-3H,1H2,(H2,10,11,14,15,18)(H2,12,13,16,17,19) |
| InChIKey | OGOQOKAXHCOJLP-UHFFFAOYSA-N |
| XLogP | -2.66 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.19 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|