C9H14N2NaO3 — CID 164960414
CID 164960414 (PubChem CID 164960414) has the molecular formula C9H14N2NaO3 and a molecular weight of 221.21 g/mol.
| Compound Name | CID 164960414 |
|---|---|
| PubChem CID | 164960414 |
| Molecular Formula | C9H14N2NaO3 |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | — |
| SMILES | CC(C)CCC1C(=O)NC(=O)NC1=O.[Na] |
| InChI | InChI=1S/C9H14N2O3.Na/c1-5(2)3-4-6-7(12)10-9(14)11-8(6)13;/h5-6H,3-4H2,1-2H3,(H2,10,11,12,13,14); |
| InChIKey | BTKXVFRLQBNHEN-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|