C9H16N2O2 — CID 130160588
5-(4-methylpentan-2-yl)imidazolidine-2,4-dione (PubChem CID 130160588) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 5-(4-methylpentan-2-yl)imidazolidine-2,4-dione.
| Compound Name | 5-(4-methylpentan-2-yl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 130160588 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 5-(4-methylpentan-2-yl)imidazolidine-2,4-dione |
| SMILES | CC(C)CC(C)C1NC(=O)NC1=O |
| InChI | InChI=1S/C9H16N2O2/c1-5(2)4-6(3)7-8(12)11-9(13)10-7/h5-7H,4H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | MPSMCPZCOAGMSW-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|