C9H15NO3 — CID 130491226
5-(4-methylpentan-2-yl)-1,3-oxazolidine-2,4-dione (PubChem CID 130491226) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is 5-(4-methylpentan-2-yl)-1,3-oxazolidine-2,4-dione.
| Compound Name | 5-(4-methylpentan-2-yl)-1,3-oxazolidine-2,4-dione |
|---|---|
| PubChem CID | 130491226 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | 5-(4-methylpentan-2-yl)-1,3-oxazolidine-2,4-dione |
| SMILES | CC(C)CC(C)C1OC(=O)NC1=O |
| InChI | InChI=1S/C9H15NO3/c1-5(2)4-6(3)7-8(11)10-9(12)13-7/h5-7H,4H2,1-3H3,(H,10,11,12) |
| InChIKey | ZNGPZXZWYCHHSB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |