C11H19N2NaO3 — CID 175394828
sodium;hydride;5-(3-methylhexyl)-1,3-diazinane-2,4,6-trione (PubChem CID 175394828) has the molecular formula C11H19N2NaO3 and a molecular weight of 250.27 g/mol. Its IUPAC name is sodium;hydride;5-(3-methylhexyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | sodium;hydride;5-(3-methylhexyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 175394828 |
| Molecular Formula | C11H19N2NaO3 |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | sodium;hydride;5-(3-methylhexyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCCC(C)CCC1C(=O)NC(=O)NC1=O.[H-].[Na+] |
| InChI | InChI=1S/C11H18N2O3.Na.H/c1-3-4-7(2)5-6-8-9(14)12-11(16)13-10(8)15;;/h7-8H,3-6H2,1-2H3,(H2,12,13,14,15,16);;/q;+1;-1 |
| InChIKey | ALNQGXTUGXFBDV-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|