C8H13N2NaO4 — CID 173201360
sodium;5-(2-ethoxyethyl)-1,3-diazinane-2,4,6-trione;hydride (PubChem CID 173201360) has the molecular formula C8H13N2NaO4 and a molecular weight of 224.19 g/mol. Its IUPAC name is sodium;5-(2-ethoxyethyl)-1,3-diazinane-2,4,6-trione;hydride.
| Compound Name | sodium;5-(2-ethoxyethyl)-1,3-diazinane-2,4,6-trione;hydride |
|---|---|
| PubChem CID | 173201360 |
| Molecular Formula | C8H13N2NaO4 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | sodium;5-(2-ethoxyethyl)-1,3-diazinane-2,4,6-trione;hydride |
| SMILES | CCOCCC1C(=O)NC(=O)NC1=O.[H-].[Na+] |
| InChI | InChI=1S/C8H12N2O4.Na.H/c1-2-14-4-3-5-6(11)9-8(13)10-7(5)12;;/h5H,2-4H2,1H3,(H2,9,10,11,12,13);;/q;+1;-1 |
| InChIKey | WEIBSWSQKLLCLN-UHFFFAOYSA-N |
| XLogP | -3.49 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|