C9H15N3O4 — CID 118541143
5-[4-(hydroxyamino)-3-methylbutyl]-1,3-diazinane-2,4,6-trione (PubChem CID 118541143) has the molecular formula C9H15N3O4 and a molecular weight of 229.24 g/mol. Its IUPAC name is 5-[4-(hydroxyamino)-3-methylbutyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[4-(hydroxyamino)-3-methylbutyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 118541143 |
| Molecular Formula | C9H15N3O4 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 5-[4-(hydroxyamino)-3-methylbutyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC(CCC1C(=O)NC(=O)NC1=O)CNO |
| InChI | InChI=1S/C9H15N3O4/c1-5(4-10-16)2-3-6-7(13)11-9(15)12-8(6)14/h5-6,10,16H,2-4H2,1H3,(H2,11,12,13,14,15) |
| InChIKey | VEGHZRDRUXBZLM-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|