C11H16N2O6 — CID 11140231
5-[[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3-diazinane-2,4,6-trione (PubChem CID 11140231) has the molecular formula C11H16N2O6 and a molecular weight of 272.26 g/mol. Its IUPAC name is 5-[[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 11140231 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 5-[[(4S,5R)-5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]methyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1(C)O[C@@H](CC2C(=O)NC(=O)NC2=O)[C@@H](CO)O1 |
| InChI | InChI=1S/C11H16N2O6/c1-11(2)18-6(7(4-14)19-11)3-5-8(15)12-10(17)13-9(5)16/h5-7,14H,3-4H2,1-2H3,(H2,12,13,15,16,17)/t6-,7+/m0/s1 |
| InChIKey | OSBFIFGZIHCWLD-NKWVEPMBSA-N |
| XLogP | -1.13 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|