About 3,4-diiodopyrrolidine-2,5-dione
3,4-diiodopyrrolidine-2,5-dione (PubChem CID 67657284) has the molecular formula C4H3I2NO2
and a molecular weight of 350.88 g/mol. Its IUPAC name is 3,4-diiodopyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3,4-diiodopyrrolidine-2,5-dione |
| PubChem CID | 67657284 |
| Molecular Formula | C4H3I2NO2 |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.83 |
| IUPAC Name | 3,4-diiodopyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(I)C1I |
| InChI | InChI=1S/C4H3I2NO2/c5-1-2(6)4(9)7-3(1)8/h1-2H,(H,7,8,9) |
| InChIKey | IXKLKYDCLVZGQK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diiodopyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diiodopyrrolidine-2,5-dione?
The IUPAC name of 3,4-diiodopyrrolidine-2,5-dione (CID 67657284) is 3,4-diiodopyrrolidine-2,5-dione.
What is the SMILES notation for 3,4-diiodopyrrolidine-2,5-dione?
The canonical SMILES for 3,4-diiodopyrrolidine-2,5-dione is O=C1NC(=O)C(I)C1I.
What is the InChIKey of 3,4-diiodopyrrolidine-2,5-dione?
The InChIKey is IXKLKYDCLVZGQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3I2NO2/c5-1-2(6)4(9)7-3(1)8/h1-2H,(H,7,8,9).
What are the key properties of 3,4-diiodopyrrolidine-2,5-dione?
3,4-diiodopyrrolidine-2,5-dione has a molecular weight of 350.88 g/mol, XLogP of 0.25, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diiodopyrrolidine-2,5-dione is sourced from PubChem (CID 67657284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).