C4H3I2NO2 — CID 67657284
3,4-diiodopyrrolidine-2,5-dione (PubChem CID 67657284) has the molecular formula C4H3I2NO2 and a molecular weight of 350.88 g/mol. Its IUPAC name is 3,4-diiodopyrrolidine-2,5-dione.
| Compound Name | 3,4-diiodopyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 67657284 |
| Molecular Formula | C4H3I2NO2 |
| Molecular Weight | 350.88 g/mol |
| Exact Mass | 350.83 |
| IUPAC Name | 3,4-diiodopyrrolidine-2,5-dione |
| SMILES | O=C1NC(=O)C(I)C1I |
| InChI | InChI=1S/C4H3I2NO2/c5-1-2(6)4(9)7-3(1)8/h1-2H,(H,7,8,9) |
| InChIKey | IXKLKYDCLVZGQK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.88 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|