C6H8INO2 — CID 170011464
3-iodo-5-methylpiperidine-2,6-dione (PubChem CID 170011464) has the molecular formula C6H8INO2 and a molecular weight of 253.04 g/mol. Its IUPAC name is 3-iodo-5-methylpiperidine-2,6-dione.
| Compound Name | 3-iodo-5-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 170011464 |
| Molecular Formula | C6H8INO2 |
| Molecular Weight | 253.04 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 3-iodo-5-methylpiperidine-2,6-dione |
| SMILES | CC1CC(I)C(=O)NC1=O |
| InChI | InChI=1S/C6H8INO2/c1-3-2-4(7)6(10)8-5(3)9/h3-4H,2H2,1H3,(H,8,9,10) |
| InChIKey | SJEGSYKKEZJTSS-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.04 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|