C5H7IN2O2 — CID 78200114
5-iodo-1-methyl-1,3-diazinane-2,4-dione (PubChem CID 78200114) has the molecular formula C5H7IN2O2 and a molecular weight of 254.03 g/mol. Its IUPAC name is 5-iodo-1-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-iodo-1-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 78200114 |
| Molecular Formula | C5H7IN2O2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 253.96 |
| IUPAC Name | 5-iodo-1-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN1CC(I)C(=O)NC1=O |
| InChI | InChI=1S/C5H7IN2O2/c1-8-2-3(6)4(9)7-5(8)10/h3H,2H2,1H3,(H,7,9,10) |
| InChIKey | NXQCCMZCSQDFIA-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|