C4H4Cl2N2O2 — CID 45035550
5,6-dichloro-1,3-diazinane-2,4-dione (PubChem CID 45035550) has the molecular formula C4H4Cl2N2O2 and a molecular weight of 182.99 g/mol. Its IUPAC name is 5,6-dichloro-1,3-diazinane-2,4-dione.
| Compound Name | 5,6-dichloro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 45035550 |
| Molecular Formula | C4H4Cl2N2O2 |
| Molecular Weight | 182.99 g/mol |
| Exact Mass | 181.96 |
| IUPAC Name | 5,6-dichloro-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)C(Cl)C(Cl)N1 |
| InChI | InChI=1S/C4H4Cl2N2O2/c5-1-2(6)7-4(10)8-3(1)9/h1-2H,(H2,7,8,9,10) |
| InChIKey | USFRCYUQIFHBMN-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.99 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|