C9H13ClN2O2 — CID 92843738
(5S)-5-[(1S,2S)-2-chlorocyclohexyl]imidazolidine-2,4-dione (PubChem CID 92843738) has the molecular formula C9H13ClN2O2 and a molecular weight of 216.67 g/mol. Its IUPAC name is (5S)-5-[(1S,2S)-2-chlorocyclohexyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[(1S,2S)-2-chlorocyclohexyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 92843738 |
| Molecular Formula | C9H13ClN2O2 |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | (5S)-5-[(1S,2S)-2-chlorocyclohexyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(=O)[C@H]([C@@H]2CCCC[C@@H]2Cl)N1 |
| InChI | InChI=1S/C9H13ClN2O2/c10-6-4-2-1-3-5(6)7-8(13)12-9(14)11-7/h5-7H,1-4H2,(H2,11,12,13,14)/t5-,6+,7+/m1/s1 |
| InChIKey | SUOIDRREDUOJAR-VQVTYTSYSA-N |
| XLogP | 0.99 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|