C14H26N2O2 — CID 143588727
5-(4-ethylcyclohexyl)imidazolidine-2,4-dione;propane (PubChem CID 143588727) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 5-(4-ethylcyclohexyl)imidazolidine-2,4-dione;propane.
| Compound Name | 5-(4-ethylcyclohexyl)imidazolidine-2,4-dione;propane |
|---|---|
| PubChem CID | 143588727 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 5-(4-ethylcyclohexyl)imidazolidine-2,4-dione;propane |
| SMILES | CCC.CCC1CCC(C2NC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C11H18N2O2.C3H8/c1-2-7-3-5-8(6-4-7)9-10(14)13-11(15)12-9;1-3-2/h7-9H,2-6H2,1H3,(H2,12,13,14,15);3H2,1-2H3 |
| InChIKey | ICZDAPOCQSFYTF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|