C14H25N2O5P — CID 11012998
(5R)-5-[(1R,2S)-2-(diethoxyphosphorylmethyl)cyclohexyl]imidazolidine-2,4-dione (PubChem CID 11012998) has the molecular formula C14H25N2O5P and a molecular weight of 332.34 g/mol. Its IUPAC name is (5R)-5-[(1R,2S)-2-(diethoxyphosphorylmethyl)cyclohexyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[(1R,2S)-2-(diethoxyphosphorylmethyl)cyclohexyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 11012998 |
| Molecular Formula | C14H25N2O5P |
| Molecular Weight | 332.34 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (5R)-5-[(1R,2S)-2-(diethoxyphosphorylmethyl)cyclohexyl]imidazolidine-2,4-dione |
| SMILES | CCOP(=O)(C[C@H]1CCCC[C@H]1[C@H]1NC(=O)NC1=O)OCC |
| InChI | InChI=1S/C14H25N2O5P/c1-3-20-22(19,21-4-2)9-10-7-5-6-8-11(10)12-13(17)16-14(18)15-12/h10-12H,3-9H2,1-2H3,(H2,15,16,17,18)/t10-,11-,12-/m1/s1 |
| InChIKey | BEYZRWKXNYPEPL-IJLUTSLNSA-N |
| XLogP | 2.27 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|