C5H7ClN2O2 — CID 45358690
5-chloro-6-methyl-1,3-diazinane-2,4-dione (PubChem CID 45358690) has the molecular formula C5H7ClN2O2 and a molecular weight of 162.58 g/mol. Its IUPAC name is 5-chloro-6-methyl-1,3-diazinane-2,4-dione.
| Compound Name | 5-chloro-6-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 45358690 |
| Molecular Formula | C5H7ClN2O2 |
| Molecular Weight | 162.58 g/mol |
| Exact Mass | 162.02 |
| IUPAC Name | 5-chloro-6-methyl-1,3-diazinane-2,4-dione |
| SMILES | CC1NC(=O)NC(=O)C1Cl |
| InChI | InChI=1S/C5H7ClN2O2/c1-2-3(6)4(9)8-5(10)7-2/h2-3H,1H3,(H2,7,8,9,10) |
| InChIKey | PYOQWTFXYQTYRV-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.58 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|