C5H8N4O3 — CID 75275021
8-hydroxy-3,4,5,7,8,9-hexahydropurine-2,6-dione (PubChem CID 75275021) has the molecular formula C5H8N4O3 and a molecular weight of 172.14 g/mol. Its IUPAC name is 8-hydroxy-3,4,5,7,8,9-hexahydropurine-2,6-dione.
| Compound Name | 8-hydroxy-3,4,5,7,8,9-hexahydropurine-2,6-dione |
|---|---|
| PubChem CID | 75275021 |
| Molecular Formula | C5H8N4O3 |
| Molecular Weight | 172.14 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | 8-hydroxy-3,4,5,7,8,9-hexahydropurine-2,6-dione |
| SMILES | O=C1NC(=O)C2NC(O)NC2N1 |
| InChI | InChI=1S/C5H8N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1-2,4,6-7,11H,(H2,8,9,10,12) |
| InChIKey | KTFXSWNYSOZVOL-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.14 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |