C4H3F3N2O2 — CID 26974624
(6R)-5,5,6-trifluoro-1,3-diazinane-2,4-dione (PubChem CID 26974624) has the molecular formula C4H3F3N2O2 and a molecular weight of 168.07 g/mol. Its IUPAC name is (6R)-5,5,6-trifluoro-1,3-diazinane-2,4-dione.
| Compound Name | (6R)-5,5,6-trifluoro-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 26974624 |
| Molecular Formula | C4H3F3N2O2 |
| Molecular Weight | 168.07 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | (6R)-5,5,6-trifluoro-1,3-diazinane-2,4-dione |
| SMILES | O=C1NC(=O)C(F)(F)[C@@H](F)N1 |
| InChI | InChI=1S/C4H3F3N2O2/c5-1-4(6,7)2(10)9-3(11)8-1/h1H,(H2,8,9,10,11)/t1-/m0/s1 |
| InChIKey | HPZYLAMUYHXEFQ-SFOWXEAESA-N |
| XLogP | -0.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.07 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|