C14H11FN2O2 — CID 101425380
(1R,2S,7S,8S)-7-fluoro-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione (PubChem CID 101425380) has the molecular formula C14H11FN2O2 and a molecular weight of 258.25 g/mol. Its IUPAC name is (1R,2S,7S,8S)-7-fluoro-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione.
| Compound Name | (1R,2S,7S,8S)-7-fluoro-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione |
|---|---|
| PubChem CID | 101425380 |
| Molecular Formula | C14H11FN2O2 |
| Molecular Weight | 258.25 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | (1R,2S,7S,8S)-7-fluoro-3,5-diazatetracyclo[6.6.2.02,7.09,14]hexadeca-9,11,13,15-tetraene-4,6-dione |
| SMILES | O=C1NC(=O)[C@]2(F)[C@H]3C=C[C@H](c4ccccc43)[C@@H]2N1 |
| InChI | InChI=1S/C14H11FN2O2/c15-14-10-6-5-9(7-3-1-2-4-8(7)10)11(14)16-13(19)17-12(14)18/h1-6,9-11H,(H2,16,17,18,19)/t9-,10+,11+,14+/m1/s1 |
| InChIKey | OVTVWYOMJSUMRT-ZHPDPMBESA-N |
| XLogP | 1.35 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.25 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|