C14H20O8 — CID 14740171
tetramethyl 3-propan-2-ylcyclopropane-1,1,2,2-tetracarboxylate (PubChem CID 14740171) has the molecular formula C14H20O8 and a molecular weight of 316.31 g/mol. Its IUPAC name is tetramethyl 3-propan-2-ylcyclopropane-1,1,2,2-tetracarboxylate.
| Compound Name | tetramethyl 3-propan-2-ylcyclopropane-1,1,2,2-tetracarboxylate |
|---|---|
| PubChem CID | 14740171 |
| Molecular Formula | C14H20O8 |
| Molecular Weight | 316.31 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | tetramethyl 3-propan-2-ylcyclopropane-1,1,2,2-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(C(C)C)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C14H20O8/c1-7(2)8-13(9(15)19-3,10(16)20-4)14(8,11(17)21-5)12(18)22-6/h7-8H,1-6H3 |
| InChIKey | LRHMVXKORAPVNJ-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.31 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|