C13H19NO6 — CID 102169085
dimethyl (1R,2S,5R)-1-nitro-2-propan-2-ylbicyclo[3.1.0]hexane-3,3-dicarboxylate (PubChem CID 102169085) has the molecular formula C13H19NO6 and a molecular weight of 285.30 g/mol. Its IUPAC name is dimethyl (1R,2S,5R)-1-nitro-2-propan-2-ylbicyclo[3.1.0]hexane-3,3-dicarboxylate.
| Compound Name | dimethyl (1R,2S,5R)-1-nitro-2-propan-2-ylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
|---|---|
| PubChem CID | 102169085 |
| Molecular Formula | C13H19NO6 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | dimethyl (1R,2S,5R)-1-nitro-2-propan-2-ylbicyclo[3.1.0]hexane-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H]2C[C@]2([N+](=O)[O-])[C@H]1C(C)C |
| InChI | InChI=1S/C13H19NO6/c1-7(2)9-12(10(15)19-3,11(16)20-4)5-8-6-13(8,9)14(17)18/h7-9H,5-6H2,1-4H3/t8-,9+,13-/m1/s1 |
| InChIKey | PCIMPUBFXBZZLF-VYUIOLGVSA-N |
| XLogP | 1.03 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|