C11H16ClNO4 — CID 101174167
methyl (1R,2S,4R)-2-chloro-7,7-dimethyl-2-nitrobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 101174167) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is methyl (1R,2S,4R)-2-chloro-7,7-dimethyl-2-nitrobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | methyl (1R,2S,4R)-2-chloro-7,7-dimethyl-2-nitrobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 101174167 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl (1R,2S,4R)-2-chloro-7,7-dimethyl-2-nitrobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | COC(=O)[C@]12CC[C@H](C[C@@]1(Cl)[N+](=O)[O-])C2(C)C |
| InChI | InChI=1S/C11H16ClNO4/c1-9(2)7-4-5-10(9,8(14)17-3)11(12,6-7)13(15)16/h7H,4-6H2,1-3H3/t7-,10+,11-/m1/s1 |
| InChIKey | STYYCLHEBHFBLE-PPKCKEKNSA-N |
| XLogP | 2.20 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|